1-hydroxy-4-unsubstituted benzenoids
Aobchem 4-Ethoxy-4 -hydroxybiphenyl | ≥95% | CAS 127972-27-4 | C14H14O2 | 250mg
4-Ethoxy-4 -hydroxybiphenyl | ≥95% | CAS 127972-27-4 | C14H14O2 | 250mg
Aobchem 4-Chloro-2-ethylphenol | ≥97% | CAS 18979-90-3 | C8H9ClO | 1g
4-Chloro-2-ethylphenol | ≥97% | CAS 18979-90-3 | C8H9ClO | 1g
Aobchem 4-Chloro-4 -hydroxybiphenyl | ≥97% | CAS 28034-99-3 | C12H9ClO | 500mg
4-Chloro-4 -hydroxybiphenyl | ≥97% | CAS 28034-99-3 | C12H9ClO | 500mg
Aobchem 4-Chloro-4 -hydroxybiphenyl | ≥97% | CAS 28034-99-3 | C12H9ClO | 5g
4-Chloro-4 -hydroxybiphenyl | ≥97% | CAS 28034-99-3 | C12H9ClO | 5g
Aobchem 3-Fluoro-4-isopropoxyphenol | ≥97% | CAS 1243280-91-2 | C9H11FO2 | 1g
3-Fluoro-4-isopropoxyphenol | ≥97% | CAS 1243280-91-2 | C9H11FO2 | 1g
Aobchem 2-Chloro-6-ethylphenol | ≥95% | CAS 24539-93-3 | C8H9ClO | 250mg
2-Chloro-6-ethylphenol | ≥95% | CAS 24539-93-3 | C8H9ClO | 250mg
Medchemexpress LLC Guaiacol carbonate | 553-17-3 | MFCD00025723 | 500mg
Guaiacol Carbonate acts as an expectorant by virtue of a reflex from the stomach by way of the afferent gastric nerves to the medullary centres and thenperipherally again to the respiratory tract[1]
Sigma Aldrich Fine Chemicals Biosciences 4-Ethylphenol >=98%, FG | 123-07-9 | MFCD00002393 | 1KG
4-Ethylphenol >=98%, FG | Purity: >=98% | Mol Wt: 122.16 | 123-07-9 | MFCD00002393 | 1KG
![eMolecules 5470-17-7 | 3-Bromo-2-chloro-5-nitropyridine | Combi-Blocks | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 117541572](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000159536.jpg-250.jpg)
eMolecules 5470-17-7 | 3-Bromo-2-chloro-5-nitropyridine | Combi-Blocks | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 117541572
3-Bromo-2-chloro-5-nitropyridine | Combi-Blocks | 5470-17-7 | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 117541572
Ambeed 2-Hydroxyphenylboronic acid | 89466-08-0 | 137.93 g/mol | 10G
2-Hydroxyphenylboronic acid | 89466-08-0 | 137.93 g/mol | 10G
Chem-Impex International, Inc. 2-Hydroxyphenylacetic acid | MFCD00004323 | 25G
2-Hydroxyphenylacetic acid, MFCD00004323, 25G
eMolecules 749878-89-5 | 3-(5-CHLORO-2-HYDROXYPHENYL)PROPANOIC ACID | MFCD09704455 | 1g
AstaTech | 3-(5-CHLORO-2-HYDROXYPHENYL)PROPANOIC ACID | 1g | 335879194 | I11661 | 95.000 | 749878-89-5 | MFCD09704455 | 200.620 | C9H9ClO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>